C24H22N2O4 — CID 2327389
3-[(1S)-1-(3,4-dimethoxyphenyl)-2-nitroethyl]-2-phenylindolizine (PubChem CID 2327389) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[(1S)-1-(3,4-dimethoxyphenyl)-2-nitroethyl]-2-phenylindolizine.
| Compound Name | 3-[(1S)-1-(3,4-dimethoxyphenyl)-2-nitroethyl]-2-phenylindolizine |
|---|---|
| PubChem CID | 2327389 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-[(1S)-1-(3,4-dimethoxyphenyl)-2-nitroethyl]-2-phenylindolizine |
| SMILES | COc1ccc([C@@H](C[N+](=O)[O-])c2c(-c3ccccc3)cc3ccccn23)cc1OC |
| InChI | InChI=1S/C24H22N2O4/c1-29-22-12-11-18(14-23(22)30-2)21(16-26(27)28)24-20(17-8-4-3-5-9-17)15-19-10-6-7-13-25(19)24/h3-15,21H,16H2,1-2H3/t21-/m1/s1 |
| InChIKey | UXANYJQFQFBTRR-OAQYLSRUSA-N |
| XLogP | 5.03 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|