C26H23NO7 — CID 1107526
2-(3,4-dimethoxyphenyl)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]indene-1,3-dione (PubChem CID 1107526) has the molecular formula C26H23NO7 and a molecular weight of 461.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]indene-1,3-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]indene-1,3-dione |
|---|---|
| PubChem CID | 1107526 |
| Molecular Formula | C26H23NO7 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-[(1S)-1-(4-methoxyphenyl)-2-nitroethyl]indene-1,3-dione |
| SMILES | COc1ccc([C@H](C[N+](=O)[O-])C2(c3ccc(OC)c(OC)c3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H23NO7/c1-32-18-11-8-16(9-12-18)21(15-27(30)31)26(17-10-13-22(33-2)23(14-17)34-3)24(28)19-6-4-5-7-20(19)25(26)29/h4-14,21H,15H2,1-3H3/t21-/m0/s1 |
| InChIKey | XUKUGAAXOXZCIB-NRFANRHFSA-N |
| XLogP | 4.09 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|