C26H20N2O3 — CID 46845392
(3S)-3-naphthalen-2-yl-3-[(1S)-2-nitro-1-phenylethyl]-1H-indol-2-one (PubChem CID 46845392) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is (3S)-3-naphthalen-2-yl-3-[(1S)-2-nitro-1-phenylethyl]-1H-indol-2-one.
| Compound Name | (3S)-3-naphthalen-2-yl-3-[(1S)-2-nitro-1-phenylethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 46845392 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (3S)-3-naphthalen-2-yl-3-[(1S)-2-nitro-1-phenylethyl]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2[C@@]1(c1ccc2ccccc2c1)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C26H20N2O3/c29-25-26(22-12-6-7-13-24(22)27-25,21-15-14-18-8-4-5-11-20(18)16-21)23(17-28(30)31)19-9-2-1-3-10-19/h1-16,23H,17H2,(H,27,29)/t23-,26-/m0/s1 |
| InChIKey | BUQKIJIHUGYPRT-OZXSUGGESA-N |
| XLogP | 5.14 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|