C24H19NO5 — CID 23931674
2-(4-methoxyphenyl)-2-(2-nitro-1-phenylethyl)indene-1,3-dione (PubChem CID 23931674) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-(2-nitro-1-phenylethyl)indene-1,3-dione.
| Compound Name | 2-(4-methoxyphenyl)-2-(2-nitro-1-phenylethyl)indene-1,3-dione |
|---|---|
| PubChem CID | 23931674 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-(2-nitro-1-phenylethyl)indene-1,3-dione |
| SMILES | COc1ccc(C2(C(C[N+](=O)[O-])c3ccccc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H19NO5/c1-30-18-13-11-17(12-14-18)24(21(15-25(28)29)16-7-3-2-4-8-16)22(26)19-9-5-6-10-20(19)23(24)27/h2-14,21H,15H2,1H3 |
| InChIKey | PFODLVZJONOURI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|