C32H25NO6 — CID 171979569
2-(4-ethoxyphenyl)-2-[1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]indene-1,3-dione (PubChem CID 171979569) has the molecular formula C32H25NO6 and a molecular weight of 519.55 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-2-[1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]indene-1,3-dione.
| Compound Name | 2-(4-ethoxyphenyl)-2-[1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]indene-1,3-dione |
|---|---|
| PubChem CID | 171979569 |
| Molecular Formula | C32H25NO6 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-(4-ethoxyphenyl)-2-[1-(4-nitrophenyl)-3-oxo-3-phenylpropyl]indene-1,3-dione |
| SMILES | CCOc1ccc(C2(C(CC(=O)c3ccccc3)c3ccc([N+](=O)[O-])cc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C32H25NO6/c1-2-39-25-18-14-23(15-19-25)32(30(35)26-10-6-7-11-27(26)31(32)36)28(20-29(34)22-8-4-3-5-9-22)21-12-16-24(17-13-21)33(37)38/h3-19,28H,2,20H2,1H3 |
| InChIKey | LMLUVFHDSIQRHP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|