C24H19ClN2O5S — CID 132584121
(5S)-5-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-3-(4-methoxyphenyl)-5-phenyl-1,3-thiazolidine-2,4-dione (PubChem CID 132584121) has the molecular formula C24H19ClN2O5S and a molecular weight of 482.95 g/mol. Its IUPAC name is (5S)-5-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-3-(4-methoxyphenyl)-5-phenyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5S)-5-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-3-(4-methoxyphenyl)-5-phenyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 132584121 |
| Molecular Formula | C24H19ClN2O5S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | (5S)-5-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-3-(4-methoxyphenyl)-5-phenyl-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(N2C(=O)S[C@](c3ccccc3)([C@H](C[N+](=O)[O-])c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H19ClN2O5S/c1-32-20-13-11-19(12-14-20)27-22(28)24(33-23(27)29,17-5-3-2-4-6-17)21(15-26(30)31)16-7-9-18(25)10-8-16/h2-14,21H,15H2,1H3/t21-,24-/m1/s1 |
| InChIKey | LOWIGJBQUYGHSP-ZJSXRUAMSA-N |
| XLogP | 5.50 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|