C19H17ClN2O4S — CID 132569235
methyl (4S)-4-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-2-phenyl-5H-1,3-thiazole-4-carboxylate (PubChem CID 132569235) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is methyl (4S)-4-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-2-phenyl-5H-1,3-thiazole-4-carboxylate.
| Compound Name | methyl (4S)-4-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-2-phenyl-5H-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 132569235 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | methyl (4S)-4-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-2-phenyl-5H-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)[C@@]1([C@H](C[N+](=O)[O-])c2ccc(Cl)cc2)CSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C19H17ClN2O4S/c1-26-18(23)19(12-27-17(21-19)14-5-3-2-4-6-14)16(11-22(24)25)13-7-9-15(20)10-8-13/h2-10,16H,11-12H2,1H3/t16-,19+/m1/s1 |
| InChIKey | YVUIJBAARBIXMJ-APWZRJJASA-N |
| XLogP | 3.81 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|