C20H20N2O4 — CID 132966127
methyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate (PubChem CID 132966127) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate.
| Compound Name | methyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 132966127 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl (2R)-2-[(1R)-2-nitro-1-phenylethyl]-5-phenyl-3,4-dihydropyrrole-2-carboxylate |
| SMILES | COC(=O)[C@]1([C@@H](C[N+](=O)[O-])c2ccccc2)CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C20H20N2O4/c1-26-19(23)20(13-12-18(21-20)16-10-6-3-7-11-16)17(14-22(24)25)15-8-4-2-5-9-15/h2-11,17H,12-14H2,1H3/t17-,20+/m0/s1 |
| InChIKey | AKEYXEQSCDXFEI-FXAWDEMLSA-N |
| XLogP | 3.24 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|