C21H19BrCl3NO5 — CID 139096106
chloroform;methyl (2R)-2-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-1-oxo-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 139096106) has the molecular formula C21H19BrCl3NO5 and a molecular weight of 551.65 g/mol. Its IUPAC name is chloroform;methyl (2R)-2-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-1-oxo-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | chloroform;methyl (2R)-2-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139096106 |
| Molecular Formula | C21H19BrCl3NO5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 548.95 |
| IUPAC Name | chloroform;methyl (2R)-2-[(1R)-1-(2-bromophenyl)-2-nitroethyl]-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)[C@@]1([C@@H](C[N+](=O)[O-])c2ccccc2Br)CCc2ccccc2C1=O.ClC(Cl)Cl |
| InChI | InChI=1S/C20H18BrNO5.CHCl3/c1-27-19(24)20(11-10-13-6-2-3-7-14(13)18(20)23)16(12-22(25)26)15-8-4-5-9-17(15)21;2-1(3)4/h2-9,16H,10-12H2,1H3;1H/t16-,20+;/m0./s1 |
| InChIKey | MADNUXWKHKUPOR-VASSOYJASA-N |
| XLogP | 5.78 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|