C18H24O4 — CID 70010309
methyl 6-hydroxy-6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hexanoate (PubChem CID 70010309) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 6-hydroxy-6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hexanoate.
| Compound Name | methyl 6-hydroxy-6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hexanoate |
|---|---|
| PubChem CID | 70010309 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl 6-hydroxy-6-(2-methyl-1-oxo-3,4-dihydronaphthalen-2-yl)hexanoate |
| SMILES | COC(=O)CCCCC(O)C1(C)CCc2ccccc2C1=O |
| InChI | InChI=1S/C18H24O4/c1-18(15(19)9-5-6-10-16(20)22-2)12-11-13-7-3-4-8-14(13)17(18)21/h3-4,7-8,15,19H,5-6,9-12H2,1-2H3 |
| InChIKey | XSYFFTLLJCLJEN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|