C12H11BrO3 — CID 101369377
methyl 2-bromo-1-oxo-3,4-dihydronaphthalene-2-carboxylate (PubChem CID 101369377) has the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. Its IUPAC name is methyl 2-bromo-1-oxo-3,4-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 2-bromo-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 101369377 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | methyl 2-bromo-1-oxo-3,4-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1(Br)CCc2ccccc2C1=O |
| InChI | InChI=1S/C12H11BrO3/c1-16-11(15)12(13)7-6-8-4-2-3-5-9(8)10(12)14/h2-5H,6-7H2,1H3 |
| InChIKey | KSXJGZMWEVLCRN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|