C16H14O3 — CID 132579646
methyl 6-oxo-9,10-dihydrophenanthrene-8a-carboxylate (PubChem CID 132579646) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 6-oxo-9,10-dihydrophenanthrene-8a-carboxylate.
| Compound Name | methyl 6-oxo-9,10-dihydrophenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 132579646 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | methyl 6-oxo-9,10-dihydrophenanthrene-8a-carboxylate |
| SMILES | COC(=O)C12C=CC(=O)C=C1c1ccccc1CC2 |
| InChI | InChI=1S/C16H14O3/c1-19-15(18)16-8-6-11-4-2-3-5-13(11)14(16)10-12(17)7-9-16/h2-5,7,9-10H,6,8H2,1H3 |
| InChIKey | JQSYXTFVIZTZDQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |