C18H20O4 — CID 102454087
dimethyl 5-methyltricyclo[7.4.0.02,5]trideca-1(13),2,9,11-tetraene-7,7-dicarboxylate (PubChem CID 102454087) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is dimethyl 5-methyltricyclo[7.4.0.02,5]trideca-1(13),2,9,11-tetraene-7,7-dicarboxylate.
| Compound Name | dimethyl 5-methyltricyclo[7.4.0.02,5]trideca-1(13),2,9,11-tetraene-7,7-dicarboxylate |
|---|---|
| PubChem CID | 102454087 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | dimethyl 5-methyltricyclo[7.4.0.02,5]trideca-1(13),2,9,11-tetraene-7,7-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2C2=CCC2(C)C1 |
| InChI | InChI=1S/C18H20O4/c1-17-9-8-14(17)13-7-5-4-6-12(13)10-18(11-17,15(19)21-2)16(20)22-3/h4-8H,9-11H2,1-3H3 |
| InChIKey | ZTXNFWFQPVRJPE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|