C24H23NO5 — CID 11269719
dimethyl 3-methyl-10-oxo-11-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),4,6,8,13,15(19)-hexaene-17,17-dicarboxylate (PubChem CID 11269719) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is dimethyl 3-methyl-10-oxo-11-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),4,6,8,13,15(19)-hexaene-17,17-dicarboxylate.
| Compound Name | dimethyl 3-methyl-10-oxo-11-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),4,6,8,13,15(19)-hexaene-17,17-dicarboxylate |
|---|---|
| PubChem CID | 11269719 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | dimethyl 3-methyl-10-oxo-11-azapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),4,6,8,13,15(19)-hexaene-17,17-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc3c(cc2C1)CC1(C)c2ccccc2C(=O)N1C3 |
| InChI | InChI=1S/C24H23NO5/c1-23-10-14-8-15-11-24(21(27)29-2,22(28)30-3)12-16(15)9-17(14)13-25(23)20(26)18-6-4-5-7-19(18)23/h4-9H,10-13H2,1-3H3 |
| InChIKey | DCVDBZMIVODCHX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|