C17H15NO2 — CID 15417705
10-methyl-8-methylidene-6-oxa-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,11,13,15-pentaen-17-one (PubChem CID 15417705) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 10-methyl-8-methylidene-6-oxa-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,11,13,15-pentaen-17-one.
| Compound Name | 10-methyl-8-methylidene-6-oxa-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,11,13,15-pentaen-17-one |
|---|---|
| PubChem CID | 15417705 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 10-methyl-8-methylidene-6-oxa-1-azatetracyclo[8.7.0.03,7.011,16]heptadeca-3(7),4,11,13,15-pentaen-17-one |
| SMILES | C=C1CC2(C)c3ccccc3C(=O)N2Cc2ccoc21 |
| InChI | InChI=1S/C17H15NO2/c1-11-9-17(2)14-6-4-3-5-13(14)16(19)18(17)10-12-7-8-20-15(11)12/h3-8H,1,9-10H2,2H3 |
| InChIKey | ALNAFDDMGLIREK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |