C16H20N2O3 — CID 163268043
ethane;3-methyl-3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 163268043) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethane;3-methyl-3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | ethane;3-methyl-3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 163268043 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethane;3-methyl-3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | CC.CC1(N2Cc3ccccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H14N2O3.C2H6/c1-14(7-6-11(17)15-13(14)19)16-8-9-4-2-3-5-10(9)12(16)18;1-2/h2-5H,6-8H2,1H3,(H,15,17,19);1-2H3 |
| InChIKey | FCGHETLXQKCCIJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|