C15H17N3O4 — CID 123881098
3-(7-amino-1-hydroxy-1-methyl-3-oxoisoindol-2-yl)-3-methylpiperidine-2,6-dione (PubChem CID 123881098) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-(7-amino-1-hydroxy-1-methyl-3-oxoisoindol-2-yl)-3-methylpiperidine-2,6-dione.
| Compound Name | 3-(7-amino-1-hydroxy-1-methyl-3-oxoisoindol-2-yl)-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 123881098 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-(7-amino-1-hydroxy-1-methyl-3-oxoisoindol-2-yl)-3-methylpiperidine-2,6-dione |
| SMILES | CC1(N2C(=O)c3cccc(N)c3C2(C)O)CCC(=O)NC1=O |
| InChI | InChI=1S/C15H17N3O4/c1-14(7-6-10(19)17-13(14)21)18-12(20)8-4-3-5-9(16)11(8)15(18,2)22/h3-5,22H,6-7,16H2,1-2H3,(H,17,19,21) |
| InChIKey | JFAWRNCOGOQARM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|