C13H14N4O4 — CID 91340958
3-(1,7-diamino-1-hydroxy-3-oxoisoindol-2-yl)piperidine-2,6-dione (PubChem CID 91340958) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-(1,7-diamino-1-hydroxy-3-oxoisoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(1,7-diamino-1-hydroxy-3-oxoisoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 91340958 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-(1,7-diamino-1-hydroxy-3-oxoisoindol-2-yl)piperidine-2,6-dione |
| SMILES | Nc1cccc2c1C(N)(O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H14N4O4/c14-7-3-1-2-6-10(7)13(15,21)17(12(6)20)8-4-5-9(18)16-11(8)19/h1-3,8,21H,4-5,14-15H2,(H,16,18,19) |
| InChIKey | VLKVAIATTORSRI-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|