C13H14N4O8 — CID 91055507
4-amino-5-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-3,3,4-trihydroxypiperidine-2,6-dione (PubChem CID 91055507) has the molecular formula C13H14N4O8 and a molecular weight of 354.28 g/mol. Its IUPAC name is 4-amino-5-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-3,3,4-trihydroxypiperidine-2,6-dione.
| Compound Name | 4-amino-5-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-3,3,4-trihydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 91055507 |
| Molecular Formula | C13H14N4O8 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-amino-5-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-3,3,4-trihydroxypiperidine-2,6-dione |
| SMILES | Nc1cccc2c1C(O)(O)N(C1C(=O)NC(=O)C(O)(O)C1(N)O)C2=O |
| InChI | InChI=1S/C13H14N4O8/c14-5-3-1-2-4-6(5)13(24,25)17(9(4)19)7-8(18)16-10(20)12(22,23)11(7,15)21/h1-3,7,21-25H,14-15H2,(H,16,18,20) |
| InChIKey | WZDKNRZVGOQZGX-UHFFFAOYSA-N |
| XLogP | -4.83 |
| TPSA | 219.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|