About 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide
2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide (PubChem CID 146273965) has the molecular formula C14H17N3O5
and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide.
Molecular Properties
| Compound Name | 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide |
| PubChem CID | 146273965 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1C(=O)c2cccc(N)c2C1(O)O |
| InChI | InChI=1S/C14H17N3O5/c1-16-12(19)10(6-3-7-18)17-13(20)8-4-2-5-9(15)11(8)14(17,21)22/h2,4-5,7,10,21-22H,3,6,15H2,1H3,(H,16,19) |
| InChIKey | KHOVBKYHYKECLX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide?
The IUPAC name of 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide (CID 146273965) is 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide.
What is the SMILES notation for 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide?
The canonical SMILES for 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide is CNC(=O)C(CCC=O)N1C(=O)c2cccc(N)c2C1(O)O.
What is the InChIKey of 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide?
The InChIKey is KHOVBKYHYKECLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O5/c1-16-12(19)10(6-3-7-18)17-13(20)8-4-2-5-9(15)11(8)14(17,21)22/h2,4-5,7,10,21-22H,3,6,15H2,1H3,(H,16,19).
What are the key properties of 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide?
2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide has a molecular weight of 307.31 g/mol, XLogP of -1.09, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-amino-1,1-dihydroxy-3-oxoisoindol-2-yl)-N-methyl-5-oxopentanamide is sourced from PubChem (CID 146273965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).