C29H37N3O4 — CID 138526825
2-[7-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 138526825) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-[7-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 138526825 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-[7-[[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(OCc3ccc(CN4CCC(C)(C)CC4)cc3)cccc2C1=O |
| InChI | InChI=1S/C29H37N3O4/c1-29(2)13-15-31(16-14-29)18-21-9-11-22(12-10-21)20-36-26-8-4-6-23-24(26)19-32(28(23)35)25(7-5-17-33)27(34)30-3/h4,6,8-12,17,25H,5,7,13-16,18-20H2,1-3H3,(H,30,34) |
| InChIKey | NRIZBZFZCMCKMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|