C27H32FN3O4 — CID 129236667
2-[7-[[4-[(4-fluoropiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 129236667) has the molecular formula C27H32FN3O4 and a molecular weight of 481.57 g/mol. Its IUPAC name is 2-[7-[[4-[(4-fluoropiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[[4-[(4-fluoropiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 129236667 |
| Molecular Formula | C27H32FN3O4 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-[7-[[4-[(4-fluoropiperidin-1-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(OCc3ccc(CN4CCC(F)CC4)cc3)cccc2C1=O |
| InChI | InChI=1S/C27H32FN3O4/c1-29-26(33)24(5-3-15-32)31-17-23-22(27(31)34)4-2-6-25(23)35-18-20-9-7-19(8-10-20)16-30-13-11-21(28)12-14-30/h2,4,6-10,15,21,24H,3,5,11-14,16-18H2,1H3,(H,29,33) |
| InChIKey | RHITZNFBJRKMFR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|