C18H29N3O3 — CID 144752994
2-(7-amino-3-oxo-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide;ethane (PubChem CID 144752994) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-(7-amino-3-oxo-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide;ethane.
| Compound Name | 2-(7-amino-3-oxo-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide;ethane |
|---|---|
| PubChem CID | 144752994 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 2-(7-amino-3-oxo-1H-isoindol-2-yl)-N-methyl-5-oxopentanamide;ethane |
| SMILES | CC.CC.CNC(=O)C(CCC=O)N1Cc2c(N)cccc2C1=O |
| InChI | InChI=1S/C14H17N3O3.2C2H6/c1-16-13(19)12(6-3-7-18)17-8-10-9(14(17)20)4-2-5-11(10)15;2*1-2/h2,4-5,7,12H,3,6,8,15H2,1H3,(H,16,19);2*1-2H3 |
| InChIKey | NPERHDNDLLILNQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|