C22H25FN2O5 — CID 156868866
fluoro 8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]oct-7-ynoate (PubChem CID 156868866) has the molecular formula C22H25FN2O5 and a molecular weight of 416.45 g/mol. Its IUPAC name is fluoro 8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]oct-7-ynoate.
| Compound Name | fluoro 8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]oct-7-ynoate |
|---|---|
| PubChem CID | 156868866 |
| Molecular Formula | C22H25FN2O5 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | fluoro 8-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1-oxo-3H-isoindol-4-yl]oct-7-ynoate |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(C#CCCCCCC(=O)OF)cccc2C1=O |
| InChI | InChI=1S/C22H25FN2O5/c1-24-21(28)19(12-8-14-26)25-15-18-16(10-7-11-17(18)22(25)29)9-5-3-2-4-6-13-20(27)30-23/h7,10-11,14,19H,2-4,6,8,12-13,15H2,1H3,(H,24,28) |
| InChIKey | GFWVJWAVUQTVBT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|