C21H22FN3O4 — CID 145069989
2-[7-[(2-fluoro-3-hydroxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 145069989) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-[7-[(2-fluoro-3-hydroxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[7-[(2-fluoro-3-hydroxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 145069989 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[7-[(2-fluoro-3-hydroxyphenyl)methylamino]-3-oxo-1H-isoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(NCc3cccc(O)c3F)cccc2C1=O |
| InChI | InChI=1S/C21H22FN3O4/c1-23-20(28)17(8-4-10-26)25-12-15-14(21(25)29)6-3-7-16(15)24-11-13-5-2-9-18(27)19(13)22/h2-3,5-7,9-10,17,24,27H,4,8,11-12H2,1H3,(H,23,28) |
| InChIKey | JJGGWQUADQPNJF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|