C29H38N4O3 — CID 166701395
N-methyl-2-[7-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide (PubChem CID 166701395) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-methyl-2-[7-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide.
| Compound Name | N-methyl-2-[7-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 166701395 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N-methyl-2-[7-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1Cc2c(CCCCN3CCN(c4cccc(C)c4)CC3)cccc2C1=O |
| InChI | InChI=1S/C29H38N4O3/c1-22-8-5-11-24(20-22)32-17-15-31(16-18-32)14-4-3-9-23-10-6-12-25-26(23)21-33(29(25)36)27(13-7-19-34)28(35)30-2/h5-6,8,10-12,19-20,27H,3-4,7,9,13-18,21H2,1-2H3,(H,30,35) |
| InChIKey | LGOOOFBTJXYOPH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|