C26H37FN4O5 — CID 134581873
8-[4-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazin-1-yl]octyl hypofluorite (PubChem CID 134581873) has the molecular formula C26H37FN4O5 and a molecular weight of 504.60 g/mol. Its IUPAC name is 8-[4-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazin-1-yl]octyl hypofluorite.
| Compound Name | 8-[4-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazin-1-yl]octyl hypofluorite |
|---|---|
| PubChem CID | 134581873 |
| Molecular Formula | C26H37FN4O5 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 8-[4-[2-[1-(methylamino)-1,5-dioxopentan-2-yl]-1,3-dioxoisoindol-5-yl]piperazin-1-yl]octyl hypofluorite |
| SMILES | CNC(=O)C(CCC=O)N1C(=O)c2ccc(N3CCN(CCCCCCCCOF)CC3)cc2C1=O |
| InChI | InChI=1S/C26H37FN4O5/c1-28-24(33)23(9-8-17-32)31-25(34)21-11-10-20(19-22(21)26(31)35)30-15-13-29(14-16-30)12-6-4-2-3-5-7-18-36-27/h10-11,17,19,23H,2-9,12-16,18H2,1H3,(H,28,33) |
| InChIKey | LFRWULUPEOUDNT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|