C29H42N8O6 — CID 156711945
methanamine;N-methyl-2-[5-[4-[2-[(2E)-3-nitro-1,6,7,8,9,10-hexahydro-1,5-diazecin-8-yl]ethyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide (PubChem CID 156711945) has the molecular formula C29H42N8O6 and a molecular weight of 598.71 g/mol. Its IUPAC name is methanamine;N-methyl-2-[5-[4-[2-[(2E)-3-nitro-1,6,7,8,9,10-hexahydro-1,5-diazecin-8-yl]ethyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide.
| Compound Name | methanamine;N-methyl-2-[5-[4-[2-[(2E)-3-nitro-1,6,7,8,9,10-hexahydro-1,5-diazecin-8-yl]ethyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 156711945 |
| Molecular Formula | C29H42N8O6 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | methanamine;N-methyl-2-[5-[4-[2-[(2E)-3-nitro-1,6,7,8,9,10-hexahydro-1,5-diazecin-8-yl]ethyl]piperazin-1-yl]-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
| SMILES | CN.CNC(=O)C(CCC=O)N1C(=O)c2ccc(N3CCN(CCC4CC/N=C/C([N+](=O)[O-])=C\NCC4)CC3)cc2C1=O |
| InChI | InChI=1S/C28H37N7O6.CH5N/c1-29-26(37)25(3-2-16-36)34-27(38)23-5-4-21(17-24(23)28(34)39)33-14-12-32(13-15-33)11-8-20-6-9-30-18-22(35(40)41)19-31-10-7-20;1-2/h4-5,16-20,25,30H,2-3,6-15H2,1H3,(H,29,37);2H2,1H3/b22-18+,31-19+; |
| InChIKey | DGBOZBYDALPNKC-YVYRYTLMSA-N |
| XLogP | 0.65 |
| TPSA | 183.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|