C27H31N5O4 — CID 174041228
2-[5-[3-[4-amino-3-[(1-methylcyclobutyl)iminomethyl]but-3-en-1-ynyl]azetidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 174041228) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-[5-[3-[4-amino-3-[(1-methylcyclobutyl)iminomethyl]but-3-en-1-ynyl]azetidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[5-[3-[4-amino-3-[(1-methylcyclobutyl)iminomethyl]but-3-en-1-ynyl]azetidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 174041228 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[5-[3-[4-amino-3-[(1-methylcyclobutyl)iminomethyl]but-3-en-1-ynyl]azetidin-1-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1C(=O)c2ccc(N3CC(C#CC(=CN)/C=N/C4(C)CCC4)C3)cc2C1=O |
| InChI | InChI=1S/C27H31N5O4/c1-27(10-4-11-27)30-15-18(14-28)6-7-19-16-31(17-19)20-8-9-21-22(13-20)26(36)32(25(21)35)23(5-3-12-33)24(34)29-2/h8-9,12-15,19,23H,3-5,10-11,16-17,28H2,1-2H3,(H,29,34)/b18-14?,30-15+ |
| InChIKey | IVBJFSCHNNOMEF-PHPMAESFSA-N |
| XLogP | 1.67 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|