C25H33ClN4O4 — CID 167063486
2-[5-[9-(2-chloroethyl)-2,9-diazaspiro[5.5]undecan-2-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide (PubChem CID 167063486) has the molecular formula C25H33ClN4O4 and a molecular weight of 489.02 g/mol. Its IUPAC name is 2-[5-[9-(2-chloroethyl)-2,9-diazaspiro[5.5]undecan-2-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[5-[9-(2-chloroethyl)-2,9-diazaspiro[5.5]undecan-2-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 167063486 |
| Molecular Formula | C25H33ClN4O4 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 2-[5-[9-(2-chloroethyl)-2,9-diazaspiro[5.5]undecan-2-yl]-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N1C(=O)c2ccc(N3CCCC4(CCN(CCCl)CC4)C3)cc2C1=O |
| InChI | InChI=1S/C25H33ClN4O4/c1-27-22(32)21(4-2-15-31)30-23(33)19-6-5-18(16-20(19)24(30)34)29-11-3-7-25(17-29)8-12-28(13-9-25)14-10-26/h5-6,15-16,21H,2-4,7-14,17H2,1H3,(H,27,32) |
| InChIKey | QJTVHWNIOSWJQC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|