C21H28N4O4 — CID 170978871
4-[5-(2,6-diazaspiro[3.3]heptan-2-yl)-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide;ethane (PubChem CID 170978871) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[5-(2,6-diazaspiro[3.3]heptan-2-yl)-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide;ethane.
| Compound Name | 4-[5-(2,6-diazaspiro[3.3]heptan-2-yl)-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide;ethane |
|---|---|
| PubChem CID | 170978871 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 4-[5-(2,6-diazaspiro[3.3]heptan-2-yl)-1,3-dioxoisoindol-2-yl]-N-methyl-5-oxopentanamide;ethane |
| SMILES | CC.CNC(=O)CCC(C=O)N1C(=O)c2ccc(N3CC4(CNC4)C3)cc2C1=O |
| InChI | InChI=1S/C19H22N4O4.C2H6/c1-20-16(25)5-3-13(7-24)23-17(26)14-4-2-12(6-15(14)18(23)27)22-10-19(11-22)8-21-9-19;1-2/h2,4,6-7,13,21H,3,5,8-11H2,1H3,(H,20,25);1-2H3 |
| InChIKey | IGCFCLRLECOKBH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|