C18H24N4O3 — CID 142407969
N-methyl-5-oxo-4-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide (PubChem CID 142407969) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-methyl-5-oxo-4-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide.
| Compound Name | N-methyl-5-oxo-4-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 142407969 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-methyl-5-oxo-4-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide |
| SMILES | CNC(=O)CCC(C=O)N1Cc2cc(N3CCNCC3)ccc2C1=O |
| InChI | InChI=1S/C18H24N4O3/c1-19-17(24)5-3-15(12-23)22-11-13-10-14(2-4-16(13)18(22)25)21-8-6-20-7-9-21/h2,4,10,12,15,20H,3,5-9,11H2,1H3,(H,19,24) |
| InChIKey | JLDVVQXDFZKYPK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|