C19H26N4O3 — CID 134580150
N,N-dimethyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide (PubChem CID 134580150) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N,N-dimethyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide.
| Compound Name | N,N-dimethyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 134580150 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N,N-dimethyl-5-oxo-2-(3-oxo-6-piperazin-1-yl-1H-isoindol-2-yl)pentanamide |
| SMILES | CN(C)C(=O)C(CCC=O)N1Cc2cc(N3CCNCC3)ccc2C1=O |
| InChI | InChI=1S/C19H26N4O3/c1-21(2)19(26)17(4-3-11-24)23-13-14-12-15(5-6-16(14)18(23)25)22-9-7-20-8-10-22/h5-6,11-12,17,20H,3-4,7-10,13H2,1-2H3 |
| InChIKey | GBRFWHIVRCVJEW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|