C17H25N3O2 — CID 177194614
4-(6-piperazin-1-yl-1,4-dihydro-2,3-benzoxazin-3-yl)pentanal (PubChem CID 177194614) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-(6-piperazin-1-yl-1,4-dihydro-2,3-benzoxazin-3-yl)pentanal.
| Compound Name | 4-(6-piperazin-1-yl-1,4-dihydro-2,3-benzoxazin-3-yl)pentanal |
|---|---|
| PubChem CID | 177194614 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 4-(6-piperazin-1-yl-1,4-dihydro-2,3-benzoxazin-3-yl)pentanal |
| SMILES | CC(CCC=O)N1Cc2cc(N3CCNCC3)ccc2CO1 |
| InChI | InChI=1S/C17H25N3O2/c1-14(3-2-10-21)20-12-16-11-17(5-4-15(16)13-22-20)19-8-6-18-7-9-19/h4-5,10-11,14,18H,2-3,6-9,12-13H2,1H3 |
| InChIKey | RHONCNCFRIBTDO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|