C17H28N4O3 — CID 169161584
hydroxylamine;2-[(5-oxopentan-2-ylamino)methyl]-4-piperazin-1-ylbenzaldehyde (PubChem CID 169161584) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is hydroxylamine;2-[(5-oxopentan-2-ylamino)methyl]-4-piperazin-1-ylbenzaldehyde.
| Compound Name | hydroxylamine;2-[(5-oxopentan-2-ylamino)methyl]-4-piperazin-1-ylbenzaldehyde |
|---|---|
| PubChem CID | 169161584 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | hydroxylamine;2-[(5-oxopentan-2-ylamino)methyl]-4-piperazin-1-ylbenzaldehyde |
| SMILES | CC(CCC=O)NCc1cc(N2CCNCC2)ccc1C=O.NO |
| InChI | InChI=1S/C17H25N3O2.H3NO/c1-14(3-2-10-21)19-12-16-11-17(5-4-15(16)13-22)20-8-6-18-7-9-20;1-2/h4-5,10-11,13-14,18-19H,2-3,6-9,12H2,1H3;2H,1H2 |
| InChIKey | FPHVQUIQLRIFSS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|