C21H26N4O3 — CID 171511071
4-[4-[4-formyl-3-[[methyl(methylamino)amino]methyl]phenyl]piperazin-1-yl]benzoic acid (PubChem CID 171511071) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[4-[4-formyl-3-[[methyl(methylamino)amino]methyl]phenyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[4-formyl-3-[[methyl(methylamino)amino]methyl]phenyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 171511071 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-[4-[4-formyl-3-[[methyl(methylamino)amino]methyl]phenyl]piperazin-1-yl]benzoic acid |
| SMILES | CNN(C)Cc1cc(N2CCN(c3ccc(C(=O)O)cc3)CC2)ccc1C=O |
| InChI | InChI=1S/C21H26N4O3/c1-22-23(2)14-18-13-20(8-5-17(18)15-26)25-11-9-24(10-12-25)19-6-3-16(4-7-19)21(27)28/h3-8,13,15,22H,9-12,14H2,1-2H3,(H,27,28) |
| InChIKey | LABYFBDUVHIBSE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|