C26H41N5O3 — CID 154670775
4-[[2-formyl-4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide (PubChem CID 154670775) has the molecular formula C26H41N5O3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-[[2-formyl-4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[[2-formyl-4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 154670775 |
| Molecular Formula | C26H41N5O3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 4-[[2-formyl-4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N(C)Cc1ccc(N2CCN(CCC3CCNCC3)CC2)cc1C=O |
| InChI | InChI=1S/C26H41N5O3/c1-27-26(34)6-5-25(20-33)29(2)18-22-3-4-24(17-23(22)19-32)31-15-13-30(14-16-31)12-9-21-7-10-28-11-8-21/h3-4,17,19-21,25,28H,5-16,18H2,1-2H3,(H,27,34) |
| InChIKey | GAWALIKXVFIMAV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|