About 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride
3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride (PubChem CID 19602805) has the molecular formula C20H33Cl2N3O2
and a molecular weight of 418.41 g/mol. Its IUPAC name is 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride |
| PubChem CID | 19602805 |
| Molecular Formula | C20H33Cl2N3O2 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)CCc1ccc(N2CCN(CCC3CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O2.2ClH/c24-20(25)6-3-17-1-4-19(5-2-17)23-15-13-22(14-16-23)12-9-18-7-10-21-11-8-18;;/h1-2,4-5,18,21H,3,6-16H2,(H,24,25);2*1H |
| InChIKey | KAOIWOBGAYFGTM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride?
The IUPAC name of 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride (CID 19602805) is 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride.
What is the SMILES notation for 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride?
The canonical SMILES for 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride is Cl.Cl.O=C(O)CCc1ccc(N2CCN(CCC3CCNCC3)CC2)cc1.
What is the InChIKey of 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride?
The InChIKey is KAOIWOBGAYFGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O2.2ClH/c24-20(25)6-3-17-1-4-19(5-2-17)23-15-13-22(14-16-23)12-9-18-7-10-21-11-8-18;;/h1-2,4-5,18,21H,3,6-16H2,(H,24,25);2*1H.
What are the key properties of 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride?
3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride has a molecular weight of 418.41 g/mol, XLogP of 3.06, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride is sourced from PubChem (CID 19602805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).