C20H33Cl2N3O2 — CID 19602805
3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride (PubChem CID 19602805) has the molecular formula C20H33Cl2N3O2 and a molecular weight of 418.41 g/mol. Its IUPAC name is 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride.
| Compound Name | 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 19602805 |
| Molecular Formula | C20H33Cl2N3O2 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenyl]propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)CCc1ccc(N2CCN(CCC3CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C20H31N3O2.2ClH/c24-20(25)6-3-17-1-4-19(5-2-17)23-15-13-22(14-16-23)12-9-18-7-10-21-11-8-18;;/h1-2,4-5,18,21H,3,6-16H2,(H,24,25);2*1H |
| InChIKey | KAOIWOBGAYFGTM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|