C23H37N3O3 — CID 19602691
butyl 2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]acetate (PubChem CID 19602691) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is butyl 2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]acetate.
| Compound Name | butyl 2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 19602691 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | butyl 2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]acetate |
| SMILES | CCCCOC(=O)COc1ccc(N2CCN(CCC3CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C23H37N3O3/c1-2-3-18-28-23(27)19-29-22-6-4-21(5-7-22)26-16-14-25(15-17-26)13-10-20-8-11-24-12-9-20/h4-7,20,24H,2-3,8-19H2,1H3 |
| InChIKey | CJAHFVNCKSKBQA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|