C26H41N3O5 — CID 19602854
tert-butyl 4-[2-[4-[4-(2-ethoxy-2-oxoethoxy)phenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate (PubChem CID 19602854) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[4-(2-ethoxy-2-oxoethoxy)phenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[4-(2-ethoxy-2-oxoethoxy)phenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19602854 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | tert-butyl 4-[2-[4-[4-(2-ethoxy-2-oxoethoxy)phenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)COc1ccc(N2CCN(CCC3CCN(C(=O)OC(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H41N3O5/c1-5-32-24(30)20-33-23-8-6-22(7-9-23)28-18-16-27(17-19-28)13-10-21-11-14-29(15-12-21)25(31)34-26(2,3)4/h6-9,21H,5,10-20H2,1-4H3 |
| InChIKey | JSSNGHQRDZQOCU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|