C23H38N4O3S — CID 143388346
tert-butyl 4-[2-[4-[4-(hydroxymethylamino)sulfanylphenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate (PubChem CID 143388346) has the molecular formula C23H38N4O3S and a molecular weight of 450.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[4-(hydroxymethylamino)sulfanylphenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[4-(hydroxymethylamino)sulfanylphenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143388346 |
| Molecular Formula | C23H38N4O3S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | tert-butyl 4-[2-[4-[4-(hydroxymethylamino)sulfanylphenyl]piperazin-1-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCN2CCN(c3ccc(SNCO)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H38N4O3S/c1-23(2,3)30-22(29)27-12-9-19(10-13-27)8-11-25-14-16-26(17-15-25)20-4-6-21(7-5-20)31-24-18-28/h4-7,19,24,28H,8-18H2,1-3H3 |
| InChIKey | OBZPZWPGHBSBSP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|