C20H37N3O4 — CID 20641747
tert-butyl 4-[2-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate (PubChem CID 20641747) has the molecular formula C20H37N3O4 and a molecular weight of 383.53 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 20641747 |
| Molecular Formula | C20H37N3O4 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | tert-butyl 4-[2-[4-(2-ethoxy-2-oxoethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)CN1CCN(CCC2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H37N3O4/c1-5-26-18(24)16-22-14-12-21(13-15-22)9-6-17-7-10-23(11-8-17)19(25)27-20(2,3)4/h17H,5-16H2,1-4H3 |
| InChIKey | KEVTZNBYJBYODB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |