C17H34N4O2 — CID 176580703
tert-butyl 4-[[1-(2-aminoethyl)piperidin-4-yl]methyl]piperazine-1-carboxylate (PubChem CID 176580703) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is tert-butyl 4-[[1-(2-aminoethyl)piperidin-4-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(2-aminoethyl)piperidin-4-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176580703 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | tert-butyl 4-[[1-(2-aminoethyl)piperidin-4-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC2CCN(CCN)CC2)CC1 |
| InChI | InChI=1S/C17H34N4O2/c1-17(2,3)23-16(22)21-12-10-20(11-13-21)14-15-4-7-19(8-5-15)9-6-18/h15H,4-14,18H2,1-3H3 |
| InChIKey | BJAYGYHGGLYRTG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |