C27H36ClN3O3 — CID 19602703
methyl 3-(4-chlorophenyl)-2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]propanoate (PubChem CID 19602703) has the molecular formula C27H36ClN3O3 and a molecular weight of 486.06 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 19602703 |
| Molecular Formula | C27H36ClN3O3 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-[4-[4-(2-piperidin-4-ylethyl)piperazin-1-yl]phenoxy]propanoate |
| SMILES | COC(=O)C(Cc1ccc(Cl)cc1)Oc1ccc(N2CCN(CCC3CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C27H36ClN3O3/c1-33-27(32)26(20-22-2-4-23(28)5-3-22)34-25-8-6-24(7-9-25)31-18-16-30(17-19-31)15-12-21-10-13-29-14-11-21/h2-9,21,26,29H,10-20H2,1H3 |
| InChIKey | XXCWDLFIDIHPJW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|