C21H32N4O4 — CID 171554747
4-[2-[formyl(methyl)amino]-N-methyl-3-(piperidin-4-ylmethoxy)anilino]-N-methyl-5-oxopentanamide (PubChem CID 171554747) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[2-[formyl(methyl)amino]-N-methyl-3-(piperidin-4-ylmethoxy)anilino]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[2-[formyl(methyl)amino]-N-methyl-3-(piperidin-4-ylmethoxy)anilino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 171554747 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 4-[2-[formyl(methyl)amino]-N-methyl-3-(piperidin-4-ylmethoxy)anilino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N(C)c1cccc(OCC2CCNCC2)c1N(C)C=O |
| InChI | InChI=1S/C21H32N4O4/c1-22-20(28)8-7-17(13-26)25(3)18-5-4-6-19(21(18)24(2)15-27)29-14-16-9-11-23-12-10-16/h4-6,13,15-17,23H,7-12,14H2,1-3H3,(H,22,28) |
| InChIKey | ZNCROCDJCYCCEO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|