C24H38N4O4S — CID 166921392
4-[[2-formyl-6-[2-(3-piperazin-1-ylpropoxy)ethylsulfanyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide (PubChem CID 166921392) has the molecular formula C24H38N4O4S and a molecular weight of 478.66 g/mol. Its IUPAC name is 4-[[2-formyl-6-[2-(3-piperazin-1-ylpropoxy)ethylsulfanyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[[2-formyl-6-[2-(3-piperazin-1-ylpropoxy)ethylsulfanyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166921392 |
| Molecular Formula | C24H38N4O4S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 4-[[2-formyl-6-[2-(3-piperazin-1-ylpropoxy)ethylsulfanyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N(C)Cc1c(C=O)cccc1SCCOCCCN1CCNCC1 |
| InChI | InChI=1S/C24H38N4O4S/c1-25-24(31)8-7-21(19-30)27(2)17-22-20(18-29)5-3-6-23(22)33-16-15-32-14-4-11-28-12-9-26-10-13-28/h3,5-6,18-19,21,26H,4,7-17H2,1-2H3,(H,25,31) |
| InChIKey | QAXCRDODXIEPCJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|