C27H41N3O3S — CID 166920982
2-[[2-[7-(3-azabicyclo[3.1.0]hexan-3-yl)heptylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide (PubChem CID 166920982) has the molecular formula C27H41N3O3S and a molecular weight of 487.71 g/mol. Its IUPAC name is 2-[[2-[7-(3-azabicyclo[3.1.0]hexan-3-yl)heptylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[[2-[7-(3-azabicyclo[3.1.0]hexan-3-yl)heptylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166920982 |
| Molecular Formula | C27H41N3O3S |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 2-[[2-[7-(3-azabicyclo[3.1.0]hexan-3-yl)heptylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)C(CCC=O)N(C)Cc1c(C=O)cccc1SCCCCCCCN1CC2CC2C1 |
| InChI | InChI=1S/C27H41N3O3S/c1-28-27(33)25(11-9-14-31)29(2)19-24-21(20-32)10-8-12-26(24)34-15-7-5-3-4-6-13-30-17-22-16-23(22)18-30/h8,10,12,14,20,22-23,25H,3-7,9,11,13,15-19H2,1-2H3,(H,28,33) |
| InChIKey | YBLFDSIGBHWHED-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|