C32H44FN3O3S — CID 166921225
2-[[2-[8-[4-(4-fluorophenyl)piperazin-1-yl]octylsulfanyl]-6-formylphenyl]methyl-methylamino]pentanedial (PubChem CID 166921225) has the molecular formula C32H44FN3O3S and a molecular weight of 569.79 g/mol. Its IUPAC name is 2-[[2-[8-[4-(4-fluorophenyl)piperazin-1-yl]octylsulfanyl]-6-formylphenyl]methyl-methylamino]pentanedial.
| Compound Name | 2-[[2-[8-[4-(4-fluorophenyl)piperazin-1-yl]octylsulfanyl]-6-formylphenyl]methyl-methylamino]pentanedial |
|---|---|
| PubChem CID | 166921225 |
| Molecular Formula | C32H44FN3O3S |
| Molecular Weight | 569.79 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | 2-[[2-[8-[4-(4-fluorophenyl)piperazin-1-yl]octylsulfanyl]-6-formylphenyl]methyl-methylamino]pentanedial |
| SMILES | CN(Cc1c(C=O)cccc1SCCCCCCCCN1CCN(c2ccc(F)cc2)CC1)C(C=O)CCC=O |
| InChI | InChI=1S/C32H44FN3O3S/c1-34(30(26-39)11-9-22-37)24-31-27(25-38)10-8-12-32(31)40-23-7-5-3-2-4-6-17-35-18-20-36(21-19-35)29-15-13-28(33)14-16-29/h8,10,12-16,22,25-26,30H,2-7,9,11,17-21,23-24H2,1H3 |
| InChIKey | HRSGZWGAXJHZNM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|