C31H42Cl2FN3O3S — CID 154690006
4-[[2-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide (PubChem CID 154690006) has the molecular formula C31H42Cl2FN3O3S and a molecular weight of 626.67 g/mol. Its IUPAC name is 4-[[2-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[[2-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 154690006 |
| Molecular Formula | C31H42Cl2FN3O3S |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | 4-[[2-[8-[1-(2,6-dichloro-3-fluorophenyl)ethylamino]octylsulfanyl]-6-formylphenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N(C)Cc1c(C=O)cccc1SCCCCCCCCNC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C31H42Cl2FN3O3S/c1-22(30-26(32)14-15-27(34)31(30)33)36-17-8-6-4-5-7-9-18-41-28-12-10-11-23(20-38)25(28)19-37(3)24(21-39)13-16-29(40)35-2/h10-12,14-15,20-22,24,36H,4-9,13,16-19H2,1-3H3,(H,35,40) |
| InChIKey | ZFEYLEAGJVMCHT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|