C22H34N2O4S — CID 166921341
4-[[2-formyl-6-(7-hydroxyheptylsulfanyl)phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide (PubChem CID 166921341) has the molecular formula C22H34N2O4S and a molecular weight of 422.59 g/mol. Its IUPAC name is 4-[[2-formyl-6-(7-hydroxyheptylsulfanyl)phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[[2-formyl-6-(7-hydroxyheptylsulfanyl)phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 166921341 |
| Molecular Formula | C22H34N2O4S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-[[2-formyl-6-(7-hydroxyheptylsulfanyl)phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)N(C)Cc1c(C=O)cccc1SCCCCCCCO |
| InChI | InChI=1S/C22H34N2O4S/c1-23-22(28)12-11-19(17-27)24(2)15-20-18(16-26)9-8-10-21(20)29-14-7-5-3-4-6-13-25/h8-10,16-17,19,25H,3-7,11-15H2,1-2H3,(H,23,28) |
| InChIKey | LOYFPMHXSJIYPB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|